About (4-acetamidophenyl) 2-phenoxybenzoate
(4-acetamidophenyl) 2-phenoxybenzoate (PubChem CID 26188165) has the molecular formula C21H17NO4
and a molecular weight of 347.37 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-phenoxybenzoate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 2-phenoxybenzoate |
| PubChem CID | 26188165 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (4-acetamidophenyl) 2-phenoxybenzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17NO4/c1-15(23)22-16-11-13-18(14-12-16)26-21(24)19-9-5-6-10-20(19)25-17-7-3-2-4-8-17/h2-14H,1H3,(H,22,23) |
| InChIKey | SPFFDRMBEBRCBG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 2-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 2-phenoxybenzoate?
The IUPAC name of (4-acetamidophenyl) 2-phenoxybenzoate (CID 26188165) is (4-acetamidophenyl) 2-phenoxybenzoate.
What is the SMILES notation for (4-acetamidophenyl) 2-phenoxybenzoate?
The canonical SMILES for (4-acetamidophenyl) 2-phenoxybenzoate is CC(=O)Nc1ccc(OC(=O)c2ccccc2Oc2ccccc2)cc1.
What is the InChIKey of (4-acetamidophenyl) 2-phenoxybenzoate?
The InChIKey is SPFFDRMBEBRCBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO4/c1-15(23)22-16-11-13-18(14-12-16)26-21(24)19-9-5-6-10-20(19)25-17-7-3-2-4-8-17/h2-14H,1H3,(H,22,23).
What are the key properties of (4-acetamidophenyl) 2-phenoxybenzoate?
(4-acetamidophenyl) 2-phenoxybenzoate has a molecular weight of 347.37 g/mol, XLogP of 4.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 2-phenoxybenzoate is sourced from PubChem (CID 26188165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).