About [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate
[(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate (PubChem CID 2498436) has the molecular formula C22H19NO4
and a molecular weight of 361.40 g/mol. Its IUPAC name is [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate.
Molecular Properties
| Compound Name | [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate |
| PubChem CID | 2498436 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1Oc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H19NO4/c1-16(21(24)23-17-10-4-2-5-11-17)26-22(25)19-14-8-9-15-20(19)27-18-12-6-3-7-13-18/h2-16H,1H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | NOSSUVGCMJJXQO-INIZCTEOSA-N |
| XLogP | 4.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate?
The IUPAC name of [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate (CID 2498436) is [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate.
What is the SMILES notation for [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate?
The canonical SMILES for [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate is C[C@H](OC(=O)c1ccccc1Oc1ccccc1)C(=O)Nc1ccccc1.
What is the InChIKey of [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate?
The InChIKey is NOSSUVGCMJJXQO-INIZCTEOSA-N. The full InChI is InChI=1S/C22H19NO4/c1-16(21(24)23-17-10-4-2-5-11-17)26-22(25)19-14-8-9-15-20(19)27-18-12-6-3-7-13-18/h2-16H,1H3,(H,23,24)/t16-/m0/s1.
What are the key properties of [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate?
[(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate has a molecular weight of 361.40 g/mol, XLogP of 4.66, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-anilino-1-oxopropan-2-yl] 2-phenoxybenzoate is sourced from PubChem (CID 2498436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).