About [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate
[(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate (PubChem CID 2509622) has the molecular formula C16H14INO3
and a molecular weight of 395.20 g/mol. Its IUPAC name is [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate.
Molecular Properties
| Compound Name | [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate |
| PubChem CID | 2509622 |
| Molecular Formula | C16H14INO3 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1I)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14INO3/c1-11(15(19)18-12-7-3-2-4-8-12)21-16(20)13-9-5-6-10-14(13)17/h2-11H,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | ZIGRYYOYVUXGKT-NSHDSACASA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate?
The IUPAC name of [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate (CID 2509622) is [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate.
What is the SMILES notation for [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate?
The canonical SMILES for [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate is C[C@H](OC(=O)c1ccccc1I)C(=O)Nc1ccccc1.
What is the InChIKey of [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate?
The InChIKey is ZIGRYYOYVUXGKT-NSHDSACASA-N. The full InChI is InChI=1S/C16H14INO3/c1-11(15(19)18-12-7-3-2-4-8-12)21-16(20)13-9-5-6-10-14(13)17/h2-11H,1H3,(H,18,19)/t11-/m0/s1.
What are the key properties of [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate?
[(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate has a molecular weight of 395.20 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-anilino-1-oxopropan-2-yl] 2-iodobenzoate is sourced from PubChem (CID 2509622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).