C20H20INO4 — CID 46812053
[1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-iodobenzoate (PubChem CID 46812053) has the molecular formula C20H20INO4 and a molecular weight of 465.29 g/mol. Its IUPAC name is [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-iodobenzoate.
| Compound Name | [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-iodobenzoate |
|---|---|
| PubChem CID | 46812053 |
| Molecular Formula | C20H20INO4 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-iodobenzoate |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)C(C)OC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C20H20INO4/c1-12(2)19(24)22-15-10-8-14(9-11-15)18(23)13(3)26-20(25)16-6-4-5-7-17(16)21/h4-13H,1-3H3,(H,22,24) |
| InChIKey | NMDOIORERKXUIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|