About [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate
[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate (PubChem CID 7950334) has the molecular formula C22H18N2O6
and a molecular weight of 406.39 g/mol. Its IUPAC name is [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate.
Molecular Properties
| Compound Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate |
| PubChem CID | 7950334 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1Oc1ccccc1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N2O6/c1-15(21(25)23-18-12-6-7-13-19(18)24(27)28)29-22(26)17-11-5-8-14-20(17)30-16-9-3-2-4-10-16/h2-15H,1H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | DADPNEIMRJTMNR-HNNXBMFYSA-N |
| XLogP | 4.57 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate?
The IUPAC name of [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate (CID 7950334) is [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate.
What is the SMILES notation for [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate?
The canonical SMILES for [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate is C[C@H](OC(=O)c1ccccc1Oc1ccccc1)C(=O)Nc1ccccc1[N+](=O)[O-].
What is the InChIKey of [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate?
The InChIKey is DADPNEIMRJTMNR-HNNXBMFYSA-N. The full InChI is InChI=1S/C22H18N2O6/c1-15(21(25)23-18-12-6-7-13-19(18)24(27)28)29-22(26)17-11-5-8-14-20(17)30-16-9-3-2-4-10-16/h2-15H,1H3,(H,23,25)/t15-/m0/s1.
What are the key properties of [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate?
[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate has a molecular weight of 406.39 g/mol, XLogP of 4.57, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-phenoxybenzoate is sourced from PubChem (CID 7950334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).