About phenoxybenzene;N-phenylacetamide
phenoxybenzene;N-phenylacetamide (PubChem CID 174350344) has the molecular formula C20H19NO2
and a molecular weight of 305.38 g/mol. Its IUPAC name is phenoxybenzene;N-phenylacetamide.
Molecular Properties
| Compound Name | phenoxybenzene;N-phenylacetamide |
| PubChem CID | 174350344 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | phenoxybenzene;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C8H9NO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(10)9-8-5-3-2-4-6-8/h1-10H;2-6H,1H3,(H,9,10) |
| InChIKey | UHISWTSMFBMARN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenoxybenzene;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxybenzene;N-phenylacetamide?
The IUPAC name of phenoxybenzene;N-phenylacetamide (CID 174350344) is phenoxybenzene;N-phenylacetamide.
What is the SMILES notation for phenoxybenzene;N-phenylacetamide?
The canonical SMILES for phenoxybenzene;N-phenylacetamide is CC(=O)Nc1ccccc1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of phenoxybenzene;N-phenylacetamide?
The InChIKey is UHISWTSMFBMARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C8H9NO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(10)9-8-5-3-2-4-6-8/h1-10H;2-6H,1H3,(H,9,10).
What are the key properties of phenoxybenzene;N-phenylacetamide?
phenoxybenzene;N-phenylacetamide has a molecular weight of 305.38 g/mol, XLogP of 5.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxybenzene;N-phenylacetamide is sourced from PubChem (CID 174350344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).