About acetyl bromide;N-phenylacetamide
acetyl bromide;N-phenylacetamide (PubChem CID 175285562) has the molecular formula C10H12BrNO2
and a molecular weight of 258.12 g/mol. Its IUPAC name is acetyl bromide;N-phenylacetamide.
Molecular Properties
| Compound Name | acetyl bromide;N-phenylacetamide |
| PubChem CID | 175285562 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | acetyl bromide;N-phenylacetamide |
| SMILES | CC(=O)Br.CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H9NO.C2H3BrO/c1-7(10)9-8-5-3-2-4-6-8;1-2(3)4/h2-6H,1H3,(H,9,10);1H3 |
| InChIKey | NTRDQBGFTJOIFV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze acetyl bromide;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl bromide;N-phenylacetamide?
The IUPAC name of acetyl bromide;N-phenylacetamide (CID 175285562) is acetyl bromide;N-phenylacetamide.
What is the SMILES notation for acetyl bromide;N-phenylacetamide?
The canonical SMILES for acetyl bromide;N-phenylacetamide is CC(=O)Br.CC(=O)Nc1ccccc1.
What is the InChIKey of acetyl bromide;N-phenylacetamide?
The InChIKey is NTRDQBGFTJOIFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C2H3BrO/c1-7(10)9-8-5-3-2-4-6-8;1-2(3)4/h2-6H,1H3,(H,9,10);1H3.
What are the key properties of acetyl bromide;N-phenylacetamide?
acetyl bromide;N-phenylacetamide has a molecular weight of 258.12 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl bromide;N-phenylacetamide is sourced from PubChem (CID 175285562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).