About N-phenylacetamide;trifluoromethanesulfonamide
N-phenylacetamide;trifluoromethanesulfonamide (PubChem CID 174361044) has the molecular formula C9H11F3N2O3S
and a molecular weight of 284.26 g/mol. Its IUPAC name is N-phenylacetamide;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-phenylacetamide;trifluoromethanesulfonamide |
| PubChem CID | 174361044 |
| Molecular Formula | C9H11F3N2O3S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-phenylacetamide;trifluoromethanesulfonamide |
| SMILES | CC(=O)Nc1ccccc1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H9NO.CH2F3NO2S/c1-7(10)9-8-5-3-2-4-6-8;2-1(3,4)8(5,6)7/h2-6H,1H3,(H,9,10);(H2,5,6,7) |
| InChIKey | YJNYNUBBBZLGJN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenylacetamide;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylacetamide;trifluoromethanesulfonamide?
The IUPAC name of N-phenylacetamide;trifluoromethanesulfonamide (CID 174361044) is N-phenylacetamide;trifluoromethanesulfonamide.
What is the SMILES notation for N-phenylacetamide;trifluoromethanesulfonamide?
The canonical SMILES for N-phenylacetamide;trifluoromethanesulfonamide is CC(=O)Nc1ccccc1.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of N-phenylacetamide;trifluoromethanesulfonamide?
The InChIKey is YJNYNUBBBZLGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.CH2F3NO2S/c1-7(10)9-8-5-3-2-4-6-8;2-1(3,4)8(5,6)7/h2-6H,1H3,(H,9,10);(H2,5,6,7).
What are the key properties of N-phenylacetamide;trifluoromethanesulfonamide?
N-phenylacetamide;trifluoromethanesulfonamide has a molecular weight of 284.26 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylacetamide;trifluoromethanesulfonamide is sourced from PubChem (CID 174361044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).