About acetohydrazide;N-phenylacetamide;hydrate
acetohydrazide;N-phenylacetamide;hydrate (PubChem CID 174786539) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is acetohydrazide;N-phenylacetamide;hydrate.
Molecular Properties
| Compound Name | acetohydrazide;N-phenylacetamide;hydrate |
| PubChem CID | 174786539 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | acetohydrazide;N-phenylacetamide;hydrate |
| SMILES | CC(=O)NN.CC(=O)Nc1ccccc1.O |
| InChI | InChI=1S/C8H9NO.C2H6N2O.H2O/c1-7(10)9-8-5-3-2-4-6-8;1-2(5)4-3;/h2-6H,1H3,(H,9,10);3H2,1H3,(H,4,5);1H2 |
| InChIKey | PAEFRKGYTDWKSS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetohydrazide;N-phenylacetamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetohydrazide;N-phenylacetamide;hydrate?
The IUPAC name of acetohydrazide;N-phenylacetamide;hydrate (CID 174786539) is acetohydrazide;N-phenylacetamide;hydrate.
What is the SMILES notation for acetohydrazide;N-phenylacetamide;hydrate?
The canonical SMILES for acetohydrazide;N-phenylacetamide;hydrate is CC(=O)NN.CC(=O)Nc1ccccc1.O.
What is the InChIKey of acetohydrazide;N-phenylacetamide;hydrate?
The InChIKey is PAEFRKGYTDWKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C2H6N2O.H2O/c1-7(10)9-8-5-3-2-4-6-8;1-2(5)4-3;/h2-6H,1H3,(H,9,10);3H2,1H3,(H,4,5);1H2.
What are the key properties of acetohydrazide;N-phenylacetamide;hydrate?
acetohydrazide;N-phenylacetamide;hydrate has a molecular weight of 227.26 g/mol, XLogP of -0.18, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetohydrazide;N-phenylacetamide;hydrate is sourced from PubChem (CID 174786539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).