About nitrous acid;N-phenylacetamide
nitrous acid;N-phenylacetamide (PubChem CID 174797407) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is nitrous acid;N-phenylacetamide.
Molecular Properties
| Compound Name | nitrous acid;N-phenylacetamide |
| PubChem CID | 174797407 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | nitrous acid;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.O=NO |
| InChI | InChI=1S/C8H9NO.HNO2/c1-7(10)9-8-5-3-2-4-6-8;2-1-3/h2-6H,1H3,(H,9,10);(H,2,3) |
| InChIKey | RHRRQOQENWBJTO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrous acid;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrous acid;N-phenylacetamide?
The IUPAC name of nitrous acid;N-phenylacetamide (CID 174797407) is nitrous acid;N-phenylacetamide.
What is the SMILES notation for nitrous acid;N-phenylacetamide?
The canonical SMILES for nitrous acid;N-phenylacetamide is CC(=O)Nc1ccccc1.O=NO.
What is the InChIKey of nitrous acid;N-phenylacetamide?
The InChIKey is RHRRQOQENWBJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.HNO2/c1-7(10)9-8-5-3-2-4-6-8;2-1-3/h2-6H,1H3,(H,9,10);(H,2,3).
What are the key properties of nitrous acid;N-phenylacetamide?
nitrous acid;N-phenylacetamide has a molecular weight of 182.18 g/mol, XLogP of 1.79, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitrous acid;N-phenylacetamide is sourced from PubChem (CID 174797407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).