About N-(4-hydroxyphenyl)acetamide;N-phenylacetamide
N-(4-hydroxyphenyl)acetamide;N-phenylacetamide (PubChem CID 174809741) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)acetamide;N-phenylacetamide.
Molecular Properties
| Compound Name | N-(4-hydroxyphenyl)acetamide;N-phenylacetamide |
| PubChem CID | 174809741 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(4-hydroxyphenyl)acetamide;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccc(O)cc1.CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C8H9NO/c1-6(10)9-7-2-4-8(11)5-3-7;1-7(10)9-8-5-3-2-4-6-8/h2-5,11H,1H3,(H,9,10);2-6H,1H3,(H,9,10) |
| InChIKey | PUKIFISWTYXDPK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxyphenyl)acetamide;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxyphenyl)acetamide;N-phenylacetamide?
The IUPAC name of N-(4-hydroxyphenyl)acetamide;N-phenylacetamide (CID 174809741) is N-(4-hydroxyphenyl)acetamide;N-phenylacetamide.
What is the SMILES notation for N-(4-hydroxyphenyl)acetamide;N-phenylacetamide?
The canonical SMILES for N-(4-hydroxyphenyl)acetamide;N-phenylacetamide is CC(=O)Nc1ccc(O)cc1.CC(=O)Nc1ccccc1.
What is the InChIKey of N-(4-hydroxyphenyl)acetamide;N-phenylacetamide?
The InChIKey is PUKIFISWTYXDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C8H9NO/c1-6(10)9-7-2-4-8(11)5-3-7;1-7(10)9-8-5-3-2-4-6-8/h2-5,11H,1H3,(H,9,10);2-6H,1H3,(H,9,10).
What are the key properties of N-(4-hydroxyphenyl)acetamide;N-phenylacetamide?
N-(4-hydroxyphenyl)acetamide;N-phenylacetamide has a molecular weight of 286.33 g/mol, XLogP of 3.00, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxyphenyl)acetamide;N-phenylacetamide is sourced from PubChem (CID 174809741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).