About N-(4-hydroxyphenyl)acetamide;iron
N-(4-hydroxyphenyl)acetamide;iron (PubChem CID 69304461) has the molecular formula C8H9FeNO2
and a molecular weight of 207.01 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)acetamide;iron.
Molecular Properties
| Compound Name | N-(4-hydroxyphenyl)acetamide;iron |
| PubChem CID | 69304461 |
| Molecular Formula | C8H9FeNO2 |
| Molecular Weight | 207.01 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | N-(4-hydroxyphenyl)acetamide;iron |
| SMILES | CC(=O)Nc1ccc(O)cc1.[Fe] |
| InChI | InChI=1S/C8H9NO2.Fe/c1-6(10)9-7-2-4-8(11)5-3-7;/h2-5,11H,1H3,(H,9,10); |
| InChIKey | DGABHQIHQMEUJY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.01 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxyphenyl)acetamide;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxyphenyl)acetamide;iron?
The IUPAC name of N-(4-hydroxyphenyl)acetamide;iron (CID 69304461) is N-(4-hydroxyphenyl)acetamide;iron.
What is the SMILES notation for N-(4-hydroxyphenyl)acetamide;iron?
The canonical SMILES for N-(4-hydroxyphenyl)acetamide;iron is CC(=O)Nc1ccc(O)cc1.[Fe].
What is the InChIKey of N-(4-hydroxyphenyl)acetamide;iron?
The InChIKey is DGABHQIHQMEUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.Fe/c1-6(10)9-7-2-4-8(11)5-3-7;/h2-5,11H,1H3,(H,9,10);.
What are the key properties of N-(4-hydroxyphenyl)acetamide;iron?
N-(4-hydroxyphenyl)acetamide;iron has a molecular weight of 207.01 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxyphenyl)acetamide;iron is sourced from PubChem (CID 69304461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).