C14H14N2O3 — CID 139679971
N-[4-(3,5-dihydroxyanilino)phenyl]acetamide (PubChem CID 139679971) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-[4-(3,5-dihydroxyanilino)phenyl]acetamide.
| Compound Name | N-[4-(3,5-dihydroxyanilino)phenyl]acetamide |
|---|---|
| PubChem CID | 139679971 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[4-(3,5-dihydroxyanilino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H14N2O3/c1-9(17)15-10-2-4-11(5-3-10)16-12-6-13(18)8-14(19)7-12/h2-8,16,18-19H,1H3,(H,15,17) |
| InChIKey | BNZUETUKXBLUMT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |