C27H27N9O3 — CID 11763127
N-[4-[[4,6-bis(4-acetamidoanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 11763127) has the molecular formula C27H27N9O3 and a molecular weight of 525.57 g/mol. Its IUPAC name is N-[4-[[4,6-bis(4-acetamidoanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[4,6-bis(4-acetamidoanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 11763127 |
| Molecular Formula | C27H27N9O3 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | N-[4-[[4,6-bis(4-acetamidoanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(Nc3ccc(NC(C)=O)cc3)nc(Nc3ccc(NC(C)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C27H27N9O3/c1-16(37)28-19-4-10-22(11-5-19)31-25-34-26(32-23-12-6-20(7-13-23)29-17(2)38)36-27(35-25)33-24-14-8-21(9-15-24)30-18(3)39/h4-15H,1-3H3,(H,28,37)(H,29,38)(H,30,39)(H3,31,32,33,34,35,36) |
| InChIKey | GUJWOWXHPUDHTQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |