C19H19N7O2 — CID 112968545
N-[4-[[3-(4-acetamidoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide (PubChem CID 112968545) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N-[4-[[3-(4-acetamidoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[3-(4-acetamidoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112968545 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[4-[[3-(4-acetamidoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cnnc(Nc3ccc(NC(C)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C19H19N7O2/c1-12(27)21-14-3-7-16(8-4-14)23-18-11-20-26-19(25-18)24-17-9-5-15(6-10-17)22-13(2)28/h3-11H,1-2H3,(H,21,27)(H,22,28)(H2,23,24,25,26) |
| InChIKey | KADFCOCJJCHHJD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |