C17H14Cl2N6O — CID 112968532
N-[3-[[5-(3,5-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide (PubChem CID 112968532) has the molecular formula C17H14Cl2N6O and a molecular weight of 389.25 g/mol. Its IUPAC name is N-[3-[[5-(3,5-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-(3,5-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112968532 |
| Molecular Formula | C17H14Cl2N6O |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[3-[[5-(3,5-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nncc(Nc3cc(Cl)cc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C17H14Cl2N6O/c1-10(26)21-13-3-2-4-14(8-13)23-17-24-16(9-20-25-17)22-15-6-11(18)5-12(19)7-15/h2-9H,1H3,(H,21,26)(H2,22,23,24,25) |
| InChIKey | OFMSTELNWFBVJM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |