C21H24N6O — CID 112965022
N-[3-[[5-(2,6-diethylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide (PubChem CID 112965022) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[3-[[5-(2,6-diethylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-(2,6-diethylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112965022 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[3-[[5-(2,6-diethylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
| SMILES | CCc1cccc(CC)c1Nc1cnnc(Nc2cccc(NC(C)=O)c2)n1 |
| InChI | InChI=1S/C21H24N6O/c1-4-15-8-6-9-16(5-2)20(15)25-19-13-22-27-21(26-19)24-18-11-7-10-17(12-18)23-14(3)28/h6-13H,4-5H2,1-3H3,(H,23,28)(H2,24,25,26,27) |
| InChIKey | RSHYKTLCVVHSCY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |