C17H14F2N6O — CID 112968543
N-[3-[[5-(3,4-difluoroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide (PubChem CID 112968543) has the molecular formula C17H14F2N6O and a molecular weight of 356.34 g/mol. Its IUPAC name is N-[3-[[5-(3,4-difluoroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-(3,4-difluoroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112968543 |
| Molecular Formula | C17H14F2N6O |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[3-[[5-(3,4-difluoroanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nncc(Nc3ccc(F)c(F)c3)n2)c1 |
| InChI | InChI=1S/C17H14F2N6O/c1-10(26)21-11-3-2-4-12(7-11)23-17-24-16(9-20-25-17)22-13-5-6-14(18)15(19)8-13/h2-9H,1H3,(H,21,26)(H2,22,23,24,25) |
| InChIKey | AZWYMPSUWPXPJG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |