C18H18N6O — CID 112961791
N-[3-[[5-(2-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide (PubChem CID 112961791) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[3-[[5-(2-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[5-(2-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112961791 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[3-[[5-(2-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nncc(Nc3ccccc3C)n2)c1 |
| InChI | InChI=1S/C18H18N6O/c1-12-6-3-4-9-16(12)22-17-11-19-24-18(23-17)21-15-8-5-7-14(10-15)20-13(2)25/h3-11H,1-2H3,(H,20,25)(H2,21,22,23,24) |
| InChIKey | NYXNXEKBJQYWMN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |