C17H13Cl2N5O — CID 112968374
1-[3-[[5-(2,3-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]ethanone (PubChem CID 112968374) has the molecular formula C17H13Cl2N5O and a molecular weight of 374.23 g/mol. Its IUPAC name is 1-[3-[[5-(2,3-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[5-(2,3-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112968374 |
| Molecular Formula | C17H13Cl2N5O |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-[3-[[5-(2,3-dichloroanilino)-1,2,4-triazin-3-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2nncc(Nc3cccc(Cl)c3Cl)n2)c1 |
| InChI | InChI=1S/C17H13Cl2N5O/c1-10(25)11-4-2-5-12(8-11)21-17-23-15(9-20-24-17)22-14-7-3-6-13(18)16(14)19/h2-9H,1H3,(H2,21,22,23,24) |
| InChIKey | WOAIDOFYDJAMLB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |