C21H25N7O — CID 112968550
N-[4-[[3-[4-(diethylamino)anilino]-1,2,4-triazin-5-yl]amino]phenyl]acetamide (PubChem CID 112968550) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[4-[[3-[4-(diethylamino)anilino]-1,2,4-triazin-5-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[3-[4-(diethylamino)anilino]-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112968550 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[4-[[3-[4-(diethylamino)anilino]-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(Nc2nncc(Nc3ccc(NC(C)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H25N7O/c1-4-28(5-2)19-12-10-18(11-13-19)25-21-26-20(14-22-27-21)24-17-8-6-16(7-9-17)23-15(3)29/h6-14H,4-5H2,1-3H3,(H,23,29)(H2,24,25,26,27) |
| InChIKey | LZMQULOVYSHAGS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|