C18H15N7O — CID 112968571
N-[4-[[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide (PubChem CID 112968571) has the molecular formula C18H15N7O and a molecular weight of 345.37 g/mol. Its IUPAC name is N-[4-[[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112968571 |
| Molecular Formula | C18H15N7O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[4-[[3-(4-cyanoanilino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cnnc(Nc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C18H15N7O/c1-12(26)21-14-6-8-15(9-7-14)22-17-11-20-25-18(24-17)23-16-4-2-13(10-19)3-5-16/h2-9,11H,1H3,(H,21,26)(H2,22,23,24,25) |
| InChIKey | UCVFUOJSSZEVQS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |