C18H16N6O — CID 112967663
4-[[3-(4-ethoxyanilino)-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 112967663) has the molecular formula C18H16N6O and a molecular weight of 332.37 g/mol. Its IUPAC name is 4-[[3-(4-ethoxyanilino)-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 4-[[3-(4-ethoxyanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112967663 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-[[3-(4-ethoxyanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | CCOc1ccc(Nc2nncc(Nc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C18H16N6O/c1-2-25-16-9-7-15(8-10-16)22-18-23-17(12-20-24-18)21-14-5-3-13(11-19)4-6-14/h3-10,12H,2H2,1H3,(H2,21,22,23,24) |
| InChIKey | XUTUEBBZJBNXSQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |