C18H19N5O2 — CID 112967197
3-N-(4-ethoxyphenyl)-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112967197) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-N-(4-ethoxyphenyl)-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(4-ethoxyphenyl)-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112967197 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-N-(4-ethoxyphenyl)-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCOc1ccc(Nc2nncc(Nc3cccc(OC)c3)n2)cc1 |
| InChI | InChI=1S/C18H19N5O2/c1-3-25-15-9-7-13(8-10-15)21-18-22-17(12-19-23-18)20-14-5-4-6-16(11-14)24-2/h4-12H,3H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | TYDBJEZXBZWRRQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |