C18H20N6O — CID 112967216
3-N-[4-(dimethylamino)phenyl]-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112967216) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-N-[4-(dimethylamino)phenyl]-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-(dimethylamino)phenyl]-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112967216 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-N-[4-(dimethylamino)phenyl]-5-N-(3-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1cccc(Nc2cnnc(Nc3ccc(N(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C18H20N6O/c1-24(2)15-9-7-13(8-10-15)21-18-22-17(12-19-23-18)20-14-5-4-6-16(11-14)25-3/h4-12H,1-3H3,(H2,20,21,22,23) |
| InChIKey | MHPRAEVXIFKNKI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|