C19H20N6O2 — CID 112968667
methyl 3-[[3-[4-(dimethylamino)anilino]-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112968667) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl 3-[[3-[4-(dimethylamino)anilino]-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | methyl 3-[[3-[4-(dimethylamino)anilino]-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112968667 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl 3-[[3-[4-(dimethylamino)anilino]-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cnnc(Nc3ccc(N(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C19H20N6O2/c1-25(2)16-9-7-14(8-10-16)22-19-23-17(12-20-24-19)21-15-6-4-5-13(11-15)18(26)27-3/h4-12H,1-3H3,(H2,21,22,23,24) |
| InChIKey | DJFMSXQEFUZNSK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|