C17H14FN5O2 — CID 112965647
methyl 3-[[3-(4-fluoroanilino)-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112965647) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is methyl 3-[[3-(4-fluoroanilino)-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | methyl 3-[[3-(4-fluoroanilino)-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112965647 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl 3-[[3-(4-fluoroanilino)-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cnnc(Nc3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C17H14FN5O2/c1-25-16(24)11-3-2-4-14(9-11)20-15-10-19-23-17(22-15)21-13-7-5-12(18)6-8-13/h2-10H,1H3,(H2,20,21,22,23) |
| InChIKey | HEYXRNKRYQDDGJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |