C19H22N6O2 — CID 112967945
5-N-(2,5-dimethoxyphenyl)-3-N-[4-(dimethylamino)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112967945) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 5-N-(2,5-dimethoxyphenyl)-3-N-[4-(dimethylamino)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,5-dimethoxyphenyl)-3-N-[4-(dimethylamino)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112967945 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 5-N-(2,5-dimethoxyphenyl)-3-N-[4-(dimethylamino)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(OC)c(Nc2cnnc(Nc3ccc(N(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C19H22N6O2/c1-25(2)14-7-5-13(6-8-14)21-19-23-18(12-20-24-19)22-16-11-15(26-3)9-10-17(16)27-4/h5-12H,1-4H3,(H2,21,22,23,24) |
| InChIKey | YBQQUBNZPSQRHD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|