C19H19N5O4 — CID 112967950
3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-N-(2,5-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112967950) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-N-(2,5-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-N-(2,5-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112967950 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-N-(2,5-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(OC)c(Nc2cnnc(Nc3ccc4c(c3)OCCO4)n2)c1 |
| InChI | InChI=1S/C19H19N5O4/c1-25-13-4-6-15(26-2)14(10-13)22-18-11-20-24-19(23-18)21-12-3-5-16-17(9-12)28-8-7-27-16/h3-6,9-11H,7-8H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | CRTGVSQXJICZMA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |