C21H26N6O2 — CID 112968056
5-N-[4-(diethylamino)phenyl]-3-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112968056) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-N-[4-(diethylamino)phenyl]-3-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[4-(diethylamino)phenyl]-3-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112968056 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 5-N-[4-(diethylamino)phenyl]-3-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(CC)c1ccc(Nc2cnnc(Nc3ccc(OC)cc3OC)n2)cc1 |
| InChI | InChI=1S/C21H26N6O2/c1-5-27(6-2)16-9-7-15(8-10-16)23-20-14-22-26-21(25-20)24-18-12-11-17(28-3)13-19(18)29-4/h7-14H,5-6H2,1-4H3,(H2,23,24,25,26) |
| InChIKey | JEIDEIAIGFOSIR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|