C19H22N6O — CID 112967686
3-N-[4-(dimethylamino)phenyl]-5-N-(2-methoxy-5-methylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112967686) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 3-N-[4-(dimethylamino)phenyl]-5-N-(2-methoxy-5-methylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-(dimethylamino)phenyl]-5-N-(2-methoxy-5-methylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112967686 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-N-[4-(dimethylamino)phenyl]-5-N-(2-methoxy-5-methylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(C)cc1Nc1cnnc(Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C19H22N6O/c1-13-5-10-17(26-4)16(11-13)22-18-12-20-24-19(23-18)21-14-6-8-15(9-7-14)25(2)3/h5-12H,1-4H3,(H2,21,22,23,24) |
| InChIKey | OKVUPVUXRKARMA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|