C15H20N6O — CID 112940211
N-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide (PubChem CID 112940211) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112940211 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]acetamide |
| SMILES | CCCCNc1nncc(Nc2ccc(NC(C)=O)cc2)n1 |
| InChI | InChI=1S/C15H20N6O/c1-3-4-9-16-15-20-14(10-17-21-15)19-13-7-5-12(6-8-13)18-11(2)22/h5-8,10H,3-4,9H2,1-2H3,(H,18,22)(H2,16,19,20,21) |
| InChIKey | UHPZMUMCVJDITR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|