C15H19N5O — CID 112940209
1-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone (PubChem CID 112940209) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112940209 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-[4-[[3-(butylamino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone |
| SMILES | CCCCNc1nncc(Nc2ccc(C(C)=O)cc2)n1 |
| InChI | InChI=1S/C15H19N5O/c1-3-4-9-16-15-19-14(10-17-20-15)18-13-7-5-12(6-8-13)11(2)21/h5-8,10H,3-4,9H2,1-2H3,(H2,16,18,19,20) |
| InChIKey | RASAXIUMJIZITE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|