C18H24N4O — CID 112876296
1-[4-[[2-methyl-6-(pentylamino)pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 112876296) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-[4-[[2-methyl-6-(pentylamino)pyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[2-methyl-6-(pentylamino)pyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112876296 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[4-[[2-methyl-6-(pentylamino)pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CCCCCNc1cc(Nc2ccc(C(C)=O)cc2)nc(C)n1 |
| InChI | InChI=1S/C18H24N4O/c1-4-5-6-11-19-17-12-18(21-14(3)20-17)22-16-9-7-15(8-10-16)13(2)23/h7-10,12H,4-6,11H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | OINNHZDLBLRRDZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|