C10H19N5 — CID 80932312
6-hydrazinyl-2-methyl-N-pentylpyrimidin-4-amine (PubChem CID 80932312) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 6-hydrazinyl-2-methyl-N-pentylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-methyl-N-pentylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80932312 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 6-hydrazinyl-2-methyl-N-pentylpyrimidin-4-amine |
| SMILES | CCCCCNc1cc(NN)nc(C)n1 |
| InChI | InChI=1S/C10H19N5/c1-3-4-5-6-12-9-7-10(15-11)14-8(2)13-9/h7H,3-6,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | KPMDMGVCQMRJBF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|