C8H16N6O2S — CID 80903168
3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]propane-1-sulfonamide (PubChem CID 80903168) has the molecular formula C8H16N6O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 80903168 |
| Molecular Formula | C8H16N6O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]propane-1-sulfonamide |
| SMILES | Cc1nc(NN)cc(NCCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C8H16N6O2S/c1-6-12-7(5-8(13-6)14-9)11-3-2-4-17(10,15)16/h5H,2-4,9H2,1H3,(H2,10,15,16)(H2,11,12,13,14) |
| InChIKey | ZOVOTCKDMXREQI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|