C10H16F3N5O2S — CID 114564759
3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propane-1-sulfonamide (PubChem CID 114564759) has the molecular formula C10H16F3N5O2S and a molecular weight of 327.33 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 114564759 |
| Molecular Formula | C10H16F3N5O2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3-[[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propane-1-sulfonamide |
| SMILES | CCNc1nc(NCCCS(N)(=O)=O)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H16F3N5O2S/c1-2-15-9-17-7(10(11,12)13)6-8(18-9)16-4-3-5-21(14,19)20/h6H,2-5H2,1H3,(H2,14,19,20)(H2,15,16,17,18) |
| InChIKey | ABUKFHITPXQIFO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|