C13H21F3N4S — CID 114565870
4-N-(4-methylsulfanylbutyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 114565870) has the molecular formula C13H21F3N4S and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-N-(4-methylsulfanylbutyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-methylsulfanylbutyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114565870 |
| Molecular Formula | C13H21F3N4S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-N-(4-methylsulfanylbutyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(NCCCCSC)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H21F3N4S/c1-3-6-18-12-19-10(13(14,15)16)9-11(20-12)17-7-4-5-8-21-2/h9H,3-8H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | VOZWTFPHSMBNGP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|