C12H19F3N4OS — CID 114565866
4-N-(3-methylsulfinylpropyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 114565866) has the molecular formula C12H19F3N4OS and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-N-(3-methylsulfinylpropyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-methylsulfinylpropyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114565866 |
| Molecular Formula | C12H19F3N4OS |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-N-(3-methylsulfinylpropyl)-2-N-propyl-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(NCCCS(C)=O)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H19F3N4OS/c1-3-5-17-11-18-9(12(13,14)15)8-10(19-11)16-6-4-7-21(2)20/h8H,3-7H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | FDJYTANOXNRZJC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|