C10H15F3N4OS — CID 114565868
2-N-methyl-4-N-(3-methylsulfinylpropyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 114565868) has the molecular formula C10H15F3N4OS and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-N-methyl-4-N-(3-methylsulfinylpropyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-(3-methylsulfinylpropyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114565868 |
| Molecular Formula | C10H15F3N4OS |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-N-methyl-4-N-(3-methylsulfinylpropyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CNc1nc(NCCCS(C)=O)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N4OS/c1-14-9-16-7(10(11,12)13)6-8(17-9)15-4-3-5-19(2)18/h6H,3-5H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | ZQWRJXCIQUOHKT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|