C9H14F3N5O2S — CID 114564127
N-[2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 114564127) has the molecular formula C9H14F3N5O2S and a molecular weight of 313.31 g/mol. Its IUPAC name is N-[2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 114564127 |
| Molecular Formula | C9H14F3N5O2S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[2-[[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CNc1nc(NCCNS(C)(=O)=O)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N5O2S/c1-13-8-16-6(9(10,11)12)5-7(17-8)14-3-4-15-20(2,18)19/h5,15H,3-4H2,1-2H3,(H2,13,14,16,17) |
| InChIKey | IZVXBSPJUBARAQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|