C8H10ClF3N4O2S — CID 114562262
N-[2-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 114562262) has the molecular formula C8H10ClF3N4O2S and a molecular weight of 318.71 g/mol. Its IUPAC name is N-[2-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 114562262 |
| Molecular Formula | C8H10ClF3N4O2S |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-[2-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C8H10ClF3N4O2S/c1-19(17,18)14-3-2-13-6-4-5(8(10,11)12)15-7(9)16-6/h4,14H,2-3H2,1H3,(H,13,15,16) |
| InChIKey | CSBINNUZGLRRAX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|