C6H9Cl2N5O2S — CID 62870440
N-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide (PubChem CID 62870440) has the molecular formula C6H9Cl2N5O2S and a molecular weight of 286.14 g/mol. Its IUPAC name is N-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 62870440 |
| Molecular Formula | C6H9Cl2N5O2S |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | N-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C6H9Cl2N5O2S/c1-16(14,15)10-3-2-9-6-12-4(7)11-5(8)13-6/h10H,2-3H2,1H3,(H,9,11,12,13) |
| InChIKey | IZHDENZHASXBJF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|