C17H24N8O8S2 — CID 90253652
5-[[4,6-bis[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 90253652) has the molecular formula C17H24N8O8S2 and a molecular weight of 532.56 g/mol. Its IUPAC name is 5-[[4,6-bis[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4,6-bis[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 90253652 |
| Molecular Formula | C17H24N8O8S2 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 5-[[4,6-bis[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | CS(=O)(=O)NCCNc1nc(NCCNS(C)(=O)=O)nc(Nc2cc(C(=O)O)cc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C17H24N8O8S2/c1-34(30,31)20-5-3-18-15-23-16(19-4-6-21-35(2,32)33)25-17(24-15)22-12-8-10(13(26)27)7-11(9-12)14(28)29/h7-9,20-21H,3-6H2,1-2H3,(H,26,27)(H,28,29)(H3,18,19,22,23,24,25) |
| InChIKey | HZYGHUVKBWTLFX-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 241.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|