C10H13BrN2O4S — CID 82801190
3-bromo-4-[2-(methanesulfonamido)ethylamino]benzoic acid (PubChem CID 82801190) has the molecular formula C10H13BrN2O4S and a molecular weight of 337.20 g/mol. Its IUPAC name is 3-bromo-4-[2-(methanesulfonamido)ethylamino]benzoic acid.
| Compound Name | 3-bromo-4-[2-(methanesulfonamido)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 82801190 |
| Molecular Formula | C10H13BrN2O4S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 3-bromo-4-[2-(methanesulfonamido)ethylamino]benzoic acid |
| SMILES | CS(=O)(=O)NCCNc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C10H13BrN2O4S/c1-18(16,17)13-5-4-12-9-3-2-7(10(14)15)6-8(9)11/h2-3,6,12-13H,4-5H2,1H3,(H,14,15) |
| InChIKey | QDFRYTKCZUWELS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|