C10H16BrN3O2S — CID 106333784
N-[3-(4-amino-2-bromoanilino)propyl]methanesulfonamide (PubChem CID 106333784) has the molecular formula C10H16BrN3O2S and a molecular weight of 322.23 g/mol. Its IUPAC name is N-[3-(4-amino-2-bromoanilino)propyl]methanesulfonamide.
| Compound Name | N-[3-(4-amino-2-bromoanilino)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106333784 |
| Molecular Formula | C10H16BrN3O2S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-[3-(4-amino-2-bromoanilino)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1ccc(N)cc1Br |
| InChI | InChI=1S/C10H16BrN3O2S/c1-17(15,16)14-6-2-5-13-10-4-3-8(12)7-9(10)11/h3-4,7,13-14H,2,5-6,12H2,1H3 |
| InChIKey | DIGRWIJXGAJWSH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|