C15H24N6O4S — CID 19357418
1-N-[3-(2,4-diaminoanilino)propyl]benzene-1,2,4-triamine;sulfuric acid (PubChem CID 19357418) has the molecular formula C15H24N6O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-N-[3-(2,4-diaminoanilino)propyl]benzene-1,2,4-triamine;sulfuric acid.
| Compound Name | 1-N-[3-(2,4-diaminoanilino)propyl]benzene-1,2,4-triamine;sulfuric acid |
|---|---|
| PubChem CID | 19357418 |
| Molecular Formula | C15H24N6O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-N-[3-(2,4-diaminoanilino)propyl]benzene-1,2,4-triamine;sulfuric acid |
| SMILES | Nc1ccc(NCCCNc2ccc(N)cc2N)c(N)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C15H22N6.H2O4S/c16-10-2-4-14(12(18)8-10)20-6-1-7-21-15-5-3-11(17)9-13(15)19;1-5(2,3)4/h2-5,8-9,20-21H,1,6-7,16-19H2;(H2,1,2,3,4) |
| InChIKey | BWKHJDHBLVDCRB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 202.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|