C12H21N3O5S2 — CID 21285173
2-[5-amino-2-(4-aminobutylamino)phenyl]sulfonylethanesulfonic acid (PubChem CID 21285173) has the molecular formula C12H21N3O5S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[5-amino-2-(4-aminobutylamino)phenyl]sulfonylethanesulfonic acid.
| Compound Name | 2-[5-amino-2-(4-aminobutylamino)phenyl]sulfonylethanesulfonic acid |
|---|---|
| PubChem CID | 21285173 |
| Molecular Formula | C12H21N3O5S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-[5-amino-2-(4-aminobutylamino)phenyl]sulfonylethanesulfonic acid |
| SMILES | NCCCCNc1ccc(N)cc1S(=O)(=O)CCS(=O)(=O)O |
| InChI | InChI=1S/C12H21N3O5S2/c13-5-1-2-6-15-11-4-3-10(14)9-12(11)21(16,17)7-8-22(18,19)20/h3-4,9,15H,1-2,5-8,13-14H2,(H,18,19,20) |
| InChIKey | MJZCTFUANYIZSH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|