C8H13ClN2O5S — CID 70564055
2-(4-amino-2-chloroanilino)ethanol;sulfuric acid (PubChem CID 70564055) has the molecular formula C8H13ClN2O5S and a molecular weight of 284.72 g/mol. Its IUPAC name is 2-(4-amino-2-chloroanilino)ethanol;sulfuric acid.
| Compound Name | 2-(4-amino-2-chloroanilino)ethanol;sulfuric acid |
|---|---|
| PubChem CID | 70564055 |
| Molecular Formula | C8H13ClN2O5S |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-(4-amino-2-chloroanilino)ethanol;sulfuric acid |
| SMILES | Nc1ccc(NCCO)c(Cl)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H11ClN2O.H2O4S/c9-7-5-6(10)1-2-8(7)11-3-4-12;1-5(2,3)4/h1-2,5,11-12H,3-4,10H2;(H2,1,2,3,4) |
| InChIKey | ZRWWZEBWBMSNLF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|