C9H13ClN2 — CID 28902196
2-chloro-1-N-propylbenzene-1,4-diamine (PubChem CID 28902196) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 2-chloro-1-N-propylbenzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 28902196 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-chloro-1-N-propylbenzene-1,4-diamine |
| SMILES | CCCNc1ccc(N)cc1Cl |
| InChI | InChI=1S/C9H13ClN2/c1-2-5-12-9-4-3-7(11)6-8(9)10/h3-4,6,12H,2,5,11H2,1H3 |
| InChIKey | WWDMLBUNAJXRGR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|